CymitQuimica logo

CAS 1389320-35-7

:

2-Propanamine, 1,1,1-trifluoro-N-methyl-, hydrochloride (1:1), (2S)-

Description:
2-Propanamine, 1,1,1-trifluoro-N-methyl-, hydrochloride (1:1), (2S)- is a chemical compound characterized by its amine functional group and the presence of trifluoromethyl substituents. This compound is a hydrochloride salt, indicating that it is the hydrochloride form of the base amine, which enhances its solubility in water and stability. The presence of the trifluoromethyl group contributes to its unique properties, such as increased lipophilicity and potential biological activity. The (2S)- designation indicates that the compound has a specific stereochemistry, which can influence its reactivity and interactions with biological systems. Generally, amines like this compound can participate in hydrogen bonding and may exhibit basicity, making them relevant in various chemical and pharmaceutical applications. The trifluoromethyl group can also impart distinct electronic properties, potentially affecting the compound's behavior in chemical reactions. Overall, this compound's characteristics make it of interest in fields such as medicinal chemistry and materials science.
Formula:C4H8F3N·ClH
InChI:InChI=1S/C4H8F3N.ClH/c1-3(8-2)4(5,6)7;/h3,8H,1-2H3;1H/t3-;/m0./s1
InChI key:InChIKey=XYLBSNZYSDBVHA-DFWYDOINSA-N
SMILES:[C@H](C(F)(F)F)(NC)C.Cl
Synonyms:
  • 2-Propanamine, 1,1,1-trifluoro-N-methyl-, hydrochloride (1:1), (2S)-
Found 1 products.