CAS 13902-62-0
:Oplodiol
Description:
Oplodiol, with the CAS number 13902-62-0, is a chemical compound that belongs to the class of organic compounds known as terpenes. It is characterized by its unique molecular structure, which typically includes multiple carbon atoms arranged in a specific configuration, contributing to its potential biological activity. Oplodiol is often studied for its applications in the field of medicinal chemistry, particularly for its possible therapeutic effects. The compound may exhibit properties such as anti-inflammatory, antimicrobial, or antioxidant activities, making it of interest for pharmaceutical research. Additionally, oplodiol's solubility and stability in various solvents can influence its behavior in biological systems and its potential uses in formulations. As with many organic compounds, the specific characteristics, including melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. Further research is necessary to fully elucidate its properties and potential applications in various fields.
Formula:C15H26O2
InChI:InChI=1S/C15H26O2/c1-10(2)11-5-7-14(3)12(9-11)15(4,17)8-6-13(14)16/h5,10,12-13,16-17H,6-9H2,1-4H3/t12-,13-,14-,15+/m1/s1
InChI key:InChIKey=SOZSXJHFVBBAOY-TUVASFSCSA-N
SMILES:C[C@@]12[C@]([C@@](C)(O)CC[C@H]1O)(CC(C(C)C)=CC2)[H]
Synonyms:- 1,4-Naphthalenediol, 1,2,3,4,4a,5,8,8a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, [1S-(1α,4α,4aα,8aβ)]-
- (1S,4R,4aR,8aR)-1,2,3,4,4a,5,8,8a-Octahydro-1,4a-dimethyl-7-(1-methylethyl)-1,4-naphthalenediol
- Eudesm-7-ene-1β,4-diol
- Oplodiol
- 1,4-Naphthalenediol, 1,2,3,4,4a,5,8,8a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1S,4R,4aR,8aR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,4-Naphthalenediol, 1,2,3,4,4a,5,8,8a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-, (1S,4R,4aR,8aR)-
CAS:Formula:C15H26O2Purity:98.0%Molecular weight:238.3657Oplodiol
CAS:<p>Oplodiol fights Plasmodium falciparum, aids osteoblast growth, and is mildly toxic to A549 lung cancer cells (IC50: 25.5 ug/mL).</p>Formula:C15H26O2Purity:98%Color and Shape:SolidMolecular weight:238.37Oplodiol
CAS:<p>Oplodiol is not a well-documented product in existing scientific literature. As an expert scientist, I must emphasize that precise details concerning Oplodiol’s classification, source, mode of action, and specific applications are not accessible through recognized scientific databases or publications. In order to provide an accurate and comprehensive description, more information from credible sources or empirical research about the product would be necessary. If Oplodiol is a novel compound or product, further peer-reviewed studies and data should be considered to adequately understand its role and potential applications in the relevant field of study.</p>Formula:C15H26O2Purity:Min. 95%Molecular weight:238.37 g/mol



