CymitQuimica logo

CAS 1391194-45-8

:

2-[2-(Acetyloxy)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]-1-cyclopropyl-2-phenylethanone

Description:
The chemical substance known as 2-[2-(Acetyloxy)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]-1-cyclopropyl-2-phenylethanone, with the CAS number 1391194-45-8, is a complex organic compound characterized by its unique structural features. It contains a thieno[3,2-c]pyridine core, which is a bicyclic structure that contributes to its potential biological activity. The presence of an acetyloxy group suggests that it may exhibit ester-like properties, potentially influencing its reactivity and solubility. Additionally, the cyclopropyl and phenyl groups attached to the ethanone moiety indicate that the compound may have interesting steric and electronic properties, which could affect its interactions in biological systems. Such compounds are often investigated for their pharmacological potential, including roles in medicinal chemistry and drug development. The specific characteristics, such as melting point, solubility, and biological activity, would require empirical data for detailed analysis, but the structural features suggest a compound of significant interest in chemical and pharmaceutical research.
Formula:C20H21NO3S
InChI:InChI=1S/C20H21NO3S/c1-13(22)24-18-11-16-12-21(10-9-17(16)25-18)19(20(23)15-7-8-15)14-5-3-2-4-6-14/h2-6,11,15,19H,7-10,12H2,1H3
InChI key:OPKDRZXNRYIANV-UHFFFAOYSA-N
SMILES:CC(=O)OC1=CC2=C(S1)CCN(C2)C(C3=CC=CC=C3)C(=O)C4CC4
Found 4 products.