CymitQuimica logo

CAS 139152-08-2

:

4,5-dichlorophthalonitrile

Description:
4,5-Dichlorophthalonitrile is an organic compound characterized by its structure, which features a phthalonitrile backbone with two chlorine substituents at the 4 and 5 positions of the aromatic ring. This compound is typically a solid at room temperature and is known for its crystalline appearance. It is relatively insoluble in water but may dissolve in organic solvents such as acetone or dichloromethane. The presence of the nitrile groups (-C≡N) contributes to its reactivity, making it useful in various chemical syntheses, particularly in the production of dyes and polymers. Additionally, the chlorine atoms enhance its electrophilic properties, allowing it to participate in further chemical reactions. 4,5-Dichlorophthalonitrile is also noted for its potential applications in materials science and as an intermediate in the synthesis of other chemical compounds. As with many chlorinated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C8H2Cl2N2
InChI:InChI=1/C8H2Cl2N2/c9-7-1-5(3-11)6(4-12)2-8(7)10/h1-2H
InChI key:SRIJSZQFAMLVQV-UHFFFAOYSA-N
SMILES:c1c(C#N)c(cc(c1Cl)Cl)C#N
Synonyms:
  • 4,5-Dichlorobenzene-1,2-Dicarbonitrile
Found 5 products.