
CAS 139264-57-6
:4-(4-Hydrazino-benzyl)-oxazolidin-2-one Hydrochloride
Description:
4-(4-Hydrazino-benzyl)-oxazolidin-2-one hydrochloride is a chemical compound characterized by its oxazolidinone core, which is a five-membered heterocyclic ring containing both nitrogen and oxygen. This compound features a hydrazino group, which is known for its reactivity and potential applications in medicinal chemistry, particularly in the development of antimicrobial and anticancer agents. The presence of the hydrochloride salt form enhances its solubility in water, making it more suitable for biological studies and pharmaceutical formulations. The molecular structure suggests that it may exhibit interesting pharmacological properties due to the combination of the hydrazino and oxazolidinone functionalities. Additionally, compounds of this nature are often investigated for their ability to interact with biological targets, potentially influencing various biochemical pathways. Safety and handling precautions should be observed, as with any chemical substance, particularly those with reactive functional groups. Overall, 4-(4-Hydrazino-benzyl)-oxazolidin-2-one hydrochloride represents a class of compounds with significant potential in drug discovery and development.
Formula:C10H13N3O2・ClH
InChI:InChI=1S/C10H13N3O2.ClH/c11-13-8-3-1-7(2-4-8)5-9-6-15-10(14)12-9;/h1-4,9,13H,5-6,11H2,(H,12,14);1H/t9-;/m0./s1
InChI key:ANOPNEVQPPHZLO-FVGYRXGTSA-N
SMILES:C1[C@@H](NC(=O)O1)CC2=CC=C(C=C2)NN.Cl
Synonyms:- 2-Oxazolidinone, 4-[(4-hydrazinophenyl)methyl]-, monohydrochloride, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Zolmitriptan Impurity 1 HCl
CAS:Formula:C10H13N3O2·HClColor and Shape:Brown SolidMolecular weight:207.23 36.46(S)-4-(4-Hydrazinobenzyl)-2-oxazolidinone Hydrochloride
CAS:Controlled ProductStability Hygroscopic
Applications (S)-4-(4-Hydrazinobenzyl)-2-oxazolidinone Hydrochloride is an Serotonin 5HTID-receptor agonist.
References Buckingham, J., et al.: J. Med. Chem., 38, 3566 (1995);Formula:C10H13N3O2Color and Shape:NeatMolecular weight:243.69


