CymitQuimica logo

CAS 139332-64-2

:

Dimethylaminosulfonylpiperazinobezoxadiazol

Description:
Dimethylaminosulfonylpiperazinobenzoxadiazol, identified by its CAS number 139332-64-2, is a chemical compound that features a complex structure incorporating a piperazine ring, a sulfonyl group, and a benzoxadiazole moiety. This compound is characterized by its potential applications in various fields, including pharmaceuticals and materials science, due to its unique electronic and structural properties. The presence of the dimethylamino group suggests that it may exhibit basic properties, which can influence its solubility and reactivity. Additionally, the sulfonyl group can enhance the compound's stability and may participate in various chemical reactions. The benzoxadiazole component is known for its fluorescent properties, making this compound potentially useful in applications such as fluorescent probes or sensors. Overall, the combination of these functional groups contributes to the compound's versatility and potential utility in research and industrial applications. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C12H17N5O3S
InChI:InChI=1/C12H17N5O3S/c1-16(2)21(18,19)10-4-3-9(11-12(10)15-20-14-11)17-7-5-13-6-8-17/h3-4,13H,5-8H2,1-2H3
InChI key:XFQLOSBBYVMBGT-UHFFFAOYSA-N
SMILES:CN(C)S(=O)(=O)c1ccc(c2c1non2)N1CCNCC1
Synonyms:
  • 4-(N,N-Dimethylsulfamoyl)-7-piperazino-benzofurazan
  • DBD-PZ [4-(N,N-dimethylaminosulfonyl)-7-piperazino-2,1,3-bezoxadiazole]
  • N,N-dimethyl-7-(piperazin-1-yl)-2,1,3-benzoxadiazole-4-sulfonamide
Found 4 products.