CymitQuimica logo

CAS 1393585-20-0

:

3-(4-Bromophenyl)-3-oxetanecarboxylic acid

Description:
3-(4-Bromophenyl)-3-oxetanecarboxylic acid is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. The presence of a bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, contributing to the compound's unique reactivity and potential biological activity. This compound features a carboxylic acid functional group, which imparts acidic properties and enhances solubility in polar solvents. The bromine substituent can influence the compound's electronic properties, potentially affecting its interactions in chemical reactions or biological systems. Additionally, the oxetane ring can serve as a reactive site, making this compound of interest in synthetic organic chemistry and medicinal chemistry. Its specific applications may vary, but compounds with similar structures are often explored for their potential in pharmaceuticals, agrochemicals, and materials science. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C10H9BrO3
InChI:InChI=1S/C10H9BrO3/c11-8-3-1-7(2-4-8)10(9(12)13)5-14-6-10/h1-4H,5-6H2,(H,12,13)
InChI key:InChIKey=XHLYQWDVGGDALC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(COC1)C2=CC=C(Br)C=C2
Synonyms:
  • 3-(4-Bromophenyl)-3-oxetanecarboxylic acid
  • 3-(4-Bromophenyl)oxetan-3-carboxylic acid
  • 3-Oxetanecarboxylic acid, 3-(4-bromophenyl)-
  • 3-(4-Bromophenyl)oxetane-3-carboxylic acid
Found 4 products.