CymitQuimica logo

CAS 1394041-32-7

:

2-Chloro-N-[5-(5-cyclopropyl-1H-tetrazol-1-yl)-2-fluorophenyl]acetamide

Description:
2-Chloro-N-[5-(5-cyclopropyl-1H-tetrazol-1-yl)-2-fluorophenyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, an acetamide functional group, and a tetrazole moiety. The presence of the cyclopropyl group and the fluorophenyl ring contributes to its unique properties, potentially influencing its biological activity and solubility. This compound is likely to exhibit polar characteristics due to the presence of the acetamide and tetrazole functionalities, which can engage in hydrogen bonding. The chloro substituent may also affect its reactivity and interaction with biological targets. Given its structural components, this compound may be of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. Its specific interactions and efficacy would depend on the context of its application, including the target biological pathways and the presence of other molecular entities. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C12H11ClFN5O
InChI:InChI=1S/C12H11ClFN5O/c13-6-11(20)15-10-5-8(3-4-9(10)14)19-12(7-1-2-7)16-17-18-19/h3-5,7H,1-2,6H2,(H,15,20)
InChI key:InChIKey=RBWISFJESDNPCC-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1C=C(N2C(=NN=N2)C3CC3)C=CC1F
Synonyms:
  • 2-Chloro-N-[5-(5-cyclopropyl-1H-tetrazol-1-yl)-2-fluorophenyl]acetamide
  • Acetamide, 2-chloro-N-[5-(5-cyclopropyl-1H-tetrazol-1-yl)-2-fluorophenyl]-
Found 1 products.