CymitQuimica logo

CAS 1394822-93-5

:

Benzeneethanol, β-amino-4-fluoro-3-(trifluoromethyl)-, hydrochloride (1:1), (βR)-

Description:
Benzeneethanol, β-amino-4-fluoro-3-(trifluoromethyl)-, hydrochloride (1:1), (βR)- is a chemical compound characterized by its complex structure, which includes a benzene ring, an alcohol functional group, and an amino group with specific fluorinated substituents. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The β-amino configuration indicates that the amino group is positioned on the β-carbon relative to the hydroxyl group, which can affect the compound's stereochemistry and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C9H9F4NO·ClH
InChI:InChI=1S/C9H9F4NO.ClH/c10-7-2-1-5(8(14)4-15)3-6(7)9(11,12)13;/h1-3,8,15H,4,14H2;1H/t8-;/m0./s1
InChI key:InChIKey=CMWVMMHOMJZAOT-QRPNPIFTSA-N
SMILES:C(F)(F)(F)C1=CC([C@H](CO)N)=CC=C1F.Cl
Synonyms:
  • Benzeneethanol, β-amino-4-fluoro-3-(trifluoromethyl)-, hydrochloride (1:1), (βR)-
Found 3 products.