CAS 13980-07-9
:8-[(2R,3R)-3-octyloxiran-2-yl]octanoic acid
Description:
8-[(2R,3R)-3-octyloxiran-2-yl]octanoic acid, with the CAS number 13980-07-9, is a chemical compound characterized by its unique structure that includes an octanoic acid backbone and an epoxide functional group. The presence of the epoxide ring, derived from the octyloxirane moiety, imparts specific reactivity and properties to the molecule, making it potentially useful in various applications, including surfactants and emulsifiers. The compound is likely to exhibit hydrophobic characteristics due to the long octyl chains, which can influence its solubility and interaction with biological membranes. Additionally, the stereochemistry indicated by the (2R,3R) configuration suggests that the compound may have specific spatial arrangements that could affect its biological activity and reactivity. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in both synthetic chemistry and potential industrial applications.
Formula:C18H34O3
InChI:InChI=1/C18H34O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/t16-,17-/m1/s1
SMILES:CCCCCCCC[C@@H]1[C@@H](CCCCCCCC(=O)O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
rac trans-9,10-Epoxystearic Acid
CAS:Controlled ProductApplications An epoxy fatty acid found in Pneumocystis carinii lipids.
References Gibson, G., et al.: Xenobiotica, 19, 1123 (1989), Pellegrini, L., et al.: Plant Physiol., 103, 509 (1993), Scheller, U., et al.: J. Biol. Chem., 273, 32528 (1998), Tijet, N., et al.: Biochem. J., 332, 583 (1998),Formula:C18H34O3Color and Shape:NeatMolecular weight:298.46

