CAS 13980-07-9

8-[(2R,3R)-3-octyloxiran-2-yl]octanoic acid

Description:

8-[(2R,3R)-3-octyloxiran-2-yl]octanoic acid, with the CAS number 13980-07-9, is a chemical compound characterized by its unique structure that includes an octanoic acid backbone and an epoxide functional group. The presence of the epoxide ring, derived from the octyloxirane moiety, imparts specific reactivity and properties to the molecule, making it potentially useful in various applications, including surfactants and emulsifiers. The compound is likely to exhibit hydrophobic characteristics due to the long octyl chains, which can influence its solubility and interaction with biological membranes. Additionally, the stereochemistry indicated by the (2R,3R) configuration suggests that the compound may have specific spatial arrangements that could affect its biological activity and reactivity. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in both synthetic chemistry and potential industrial applications.

Formula: C₁₈H₃₄O₃

InChI: InChI=1/C18H34O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/t16-,17-/m1/s1

SMILES: CCCCCCCC[C@@H]1[C@@H](CCCCCCCC(=O)O)O1

rac trans-9,10-Epoxystearic Acid

CAS: 13980-07-9

Formula: C₁₈H₃₄O₃

Color and Shape: Solid

Molecular weight: 298.4608

Ref: IN-DA001BPY

trans-9,10-Epoxy-octadecanoic acid

CAS: 13980-07-9

Formula: C18H34O3

Purity: >98%

Color and Shape: In solution, Methanol

Molecular weight: 298.46

Ref: 48-12-1811

rac trans-9,10-Epoxystearic Acid

Controlled Product

CAS: 13980-07-9

Applications An epoxy fatty acid found in Pneumocystis carinii lipids.
References Gibson, G., et al.: Xenobiotica, 19, 1123 (1989), Pellegrini, L., et al.: Plant Physiol., 103, 509 (1993), Scheller, U., et al.: J. Biol. Chem., 273, 32528 (1998), Tijet, N., et al.: Biochem. J., 332, 583 (1998),

Formula: C₁₈H₃₄O₃

Color and Shape: Neat

Molecular weight: 298.46

Ref: TR-E589900