CymitQuimica logo

CAS 14016-01-4

:

3-oxo-2,3-dihydro-1,2-oxazole-5-carboxamide

Description:
3-Oxo-2,3-dihydro-1,2-oxazole-5-carboxamide, with the CAS number 14016-01-4, is a heterocyclic compound featuring an oxazole ring, which is characterized by its five-membered structure containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with both amides and oxazoles, including potential polar characteristics due to the presence of the carboxamide functional group. It may display moderate solubility in polar solvents, and its reactivity can be influenced by the carbonyl and nitrogen functionalities, allowing for various chemical transformations. The oxazole ring contributes to its stability and may also impart biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. Overall, 3-oxo-2,3-dihydro-1,2-oxazole-5-carboxamide is a versatile compound with unique chemical properties that can be explored in various scientific fields.
Formula:C4H4N2O3
InChI:InChI=1/C4H4N2O3/c5-4(8)2-1-3(7)6-9-2/h1H,(H2,5,8)(H,6,7)
InChI key:VAXZHEOQJVBMQW-UHFFFAOYSA-N
SMILES:c1c(C(=N)O)onc1O
Found 4 products.