CymitQuimica logo

CAS 140164-85-8

:

Chloromethylformylmethylaminonitrobenzox

Description:
Chloromethylformylmethylaminonitrobenzox, identified by its CAS number 140164-85-8, is a synthetic organic compound that features a complex molecular structure. It typically contains functional groups such as chloromethyl, formyl, and amino, which contribute to its reactivity and potential applications in various chemical processes. The presence of a nitro group suggests that it may exhibit significant electron-withdrawing properties, influencing its chemical behavior and interactions. This compound may be utilized in pharmaceutical research or as an intermediate in organic synthesis, although specific applications can vary based on its reactivity and stability. Its physical properties, such as solubility, melting point, and boiling point, would depend on the specific molecular interactions and the presence of substituents. Safety data and handling precautions are essential when working with this compound, as it may pose health risks due to its reactive nature. As with any chemical substance, proper characterization and understanding of its properties are crucial for safe and effective use in laboratory or industrial settings.
Formula:C9H7ClN4O4
InChI:InChI=1/C9H7ClN4O4/c1-13(4-7(10)15)5-2-3-6(14(16)17)9-8(5)11-18-12-9/h2-3H,4H2,1H3
InChI key:BLKGIXBLRWZLKS-UHFFFAOYSA-N
SMILES:CN(CC(=O)Cl)c1ccc(c2c1non2)N(=O)=O
Synonyms:
  • NBD-COCL [=4-(N-Chloromethylformyl-N-methylamino)-7-nitro-2,1,3-benzoxadiazole]
  • N-methyl-N-(7-nitro-2,1,3-benzoxadiazol-4-yl)glycyl chloride
Found 3 products.