CymitQuimica logo

CAS 1403323-06-7

:

cis-3-Aminocyclohexanecarbonitrile hydrochloride

Description:
Cis-3-Aminocyclohexanecarbonitrile hydrochloride is a chemical compound characterized by its unique structural features, including a cyclohexane ring with an amino group and a carbonitrile functional group. The "cis" designation indicates that the amino and carbonitrile groups are positioned on the same side of the cyclohexane ring, which can influence the compound's stereochemistry and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests potential for biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Additionally, the carbonitrile group can participate in further chemical reactions, allowing for the synthesis of derivatives. Overall, this compound's characteristics, including its solubility, reactivity, and stereochemistry, make it a valuable subject of study in organic and medicinal chemistry.
Formula:C7H13ClN2
InChI:InChI=1S/C7H12N2.ClH/c8-5-6-2-1-3-7(9)4-6;/h6-7H,1-4,9H2;1H/t6-,7+;/m1./s1
InChI key:ZBUXGIYHCTWUTA-HHQFNNIRSA-N
SMILES:C1C[C@H](C[C@H](C1)N)C#N.Cl
Synonyms:
  • Cis-3-aminocyclohexanecarbonitrile
  • cis-3-Aminocyclohexanecarbonitrile hydrochloride
  • Cyclohexanecarbonitrile, 3-amino-, hydrochloride (1:1), (1R,3S)-rel-
Found 3 products.