CymitQuimica logo

CAS 1403783-31-2

:

Nexturastat A

Description:
Nexturastat A is a small molecule inhibitor primarily known for its role in targeting the enzyme histone deacetylase 6 (HDAC6). This compound is notable for its potential therapeutic applications, particularly in the context of cancer treatment and neurodegenerative diseases. Nexturastat A exhibits characteristics typical of HDAC inhibitors, such as the ability to modulate gene expression by altering histone acetylation status, which can influence cellular processes like proliferation, differentiation, and apoptosis. The compound has shown promise in preclinical studies, demonstrating efficacy in reducing tumor growth and enhancing the effects of other anticancer therapies. Additionally, its selectivity for HDAC6 over other isoforms may contribute to a favorable side effect profile. As a synthetic compound, Nexturastat A's chemical structure includes functional groups that facilitate its interaction with the target enzyme, making it a subject of interest in ongoing research aimed at developing novel cancer therapeutics. Overall, Nexturastat A represents a significant advancement in the field of epigenetic modulation and targeted cancer therapy.
Formula:C19H23N3O3
InChI:InChI=1S/C19H23N3O3/c1-2-3-13-22(19(24)20-17-7-5-4-6-8-17)14-15-9-11-16(12-10-15)18(23)21-25/h4-12,25H,2-3,13-14H2,1H3,(H,20,24)(H,21,23)
InChI key:JZWXMCPARMXZQV-UHFFFAOYSA-N
SMILES:CCCCN(CC1=CC=C(C=C1)C(=O)NO)C(=O)NC2=CC=CC=C2
Found 9 products.