CymitQuimica logo

CAS 1404373-76-7

:

2-Chloro-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one hydrochloride (1:1)

Description:
2-Chloro-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one hydrochloride is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine moieties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The presence of the chlorine atom at the 2-position and the carbonyl group at the 6-position contributes to its reactivity and potential biological activity. It may exhibit properties such as antimicrobial or antiviral activity, making it of interest in pharmaceutical research. The hydrochloride form enhances its stability and solubility, facilitating its use in various applications, including drug formulation. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any potential hazards associated with its use.
Formula:C6H5Cl2N3O
InChI:InChI=1S/C6H4ClN3O.ClH/c7-6-8-2-3-1-4(11)9-5(3)10-6;/h2H,1H2,(H,8,9,10,11);1H
InChI key:JFGBLYHQRSOZBN-UHFFFAOYSA-N
SMILES:C1C2=CN=C(N=C2NC1=O)Cl.Cl
Found 3 products.