CAS 140663-38-3
:H-7
Description:
H-7, with the CAS number 140663-38-3, is a chemical compound known for its role as a selective inhibitor of certain protein kinases, particularly in the context of research involving cellular signaling pathways. It is often utilized in biochemical studies to investigate the effects of kinase inhibition on various cellular processes, including proliferation, differentiation, and apoptosis. The compound is characterized by its ability to modulate specific signaling cascades, making it a valuable tool in pharmacological research and drug development. H-7 is typically administered in vitro and has been studied for its potential therapeutic applications in various diseases, including cancer. Its mechanism of action involves the disruption of ATP binding to kinases, thereby inhibiting their activity. As with many chemical substances, safety and handling precautions are essential, as H-7 may pose risks if not managed properly in laboratory settings. Overall, H-7 serves as an important compound in the field of molecular biology and pharmacology, contributing to the understanding of kinase-related pathways.
Formula:C14H19Cl2N3O2S
InChI:InChI=1/C14H17N3O2S.2ClH/c1-11-10-17(8-7-16-11)20(18,19)14-4-2-3-12-9-15-6-5-13(12)14;;/h2-6,9,11,16H,7-8,10H2,1H3;2*1H
SMILES:CC1CN(CCN1)S(=O)(=O)c1cccc2cnccc12.Cl.Cl
Synonyms:- 5-[(3-Methylpiperazin-1-Yl)Sulfonyl]Isoquinoline Dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Iso-H7 dihydrochloride
CAS:Iso-H7 dihydrochlorideFormula:C14H19Cl2N3O2SPurity:≥98%Molecular weight:364.29Iso-H7 dihydrochloride
CAS:Iso-H7 dihydrochloride is a less potent inhibitor of phosphokinase C than H-7.Formula:C14H19Cl2N3O2SPurity:99.53%Color and Shape:White Crystalline SolidMolecular weight:364.29Iso-H7 dihydrochloride
CAS:Iso-H7 is a protein that belongs to the group of growth factors. It is an incompletely folded form of epidermal growth factor (EGF) that is able to bind to EGF receptors in cell membranes. Iso-H7 has been shown to have regulatory, pleiotropic, and cellular activities. It can be used as an antigen for the production of monoclonal antibodies, as well as for the development of drugs against viral infections and cancer. Iso-H7 stimulates cellular growth by activating phosphatase activity and inhibiting epidermal growth factor receptor phosphorylation in response to epidermal growth factor binding.Formula:C14H19Cl2N3O2SPurity:Min. 95%Molecular weight:364.29 g/mol



