CAS 14080-56-9
:Thieno[2,3-d]pyrimidin-4-amine
Description:
Thieno[2,3-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by a fused ring system that includes both thiophene and pyrimidine moieties. This compound typically exhibits a pale to light yellow crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals targeting various diseases. The presence of the amino group at the 4-position of the pyrimidine ring enhances its reactivity and solubility in polar solvents. Thieno[2,3-d]pyrimidin-4-amine is often studied for its role in the synthesis of more complex molecules and its potential as a kinase inhibitor. Its molecular structure contributes to its electronic properties, making it a subject of interest in materials science as well. Additionally, the compound's stability and reactivity can be influenced by substituents on the ring, which can modulate its pharmacological properties. Overall, Thieno[2,3-d]pyrimidin-4-amine represents a versatile compound in both synthetic and medicinal chemistry.
Formula:C6H5N3S
InChI:InChI=1S/C6H5N3S/c7-5-4-1-2-10-6(4)9-3-8-5/h1-3H,(H2,7,8,9)
InChI key:InChIKey=DYTQGJLVGDSCLF-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=N1)SC=C2
Synonyms:- 4-Aminothieno[2,3-d]pyrimidine
- Thieno[2,3-D]Pyrimidin-4-Ylamine
- Thieno[2,3-d]pyrimidine, 4-amino-
- Thieno[2,3-d]pyrimidin-4-amine
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Aminothieno[2,3-d]pyrimidine
CAS:4-Aminothieno[2,3-d]pyrimidineFormula:C6H5N3SPurity:≥95%Color and Shape:SolidMolecular weight:151.189Thieno[2,3-d]pyrimidin-4-amine
CAS:Formula:C6H5N3SPurity:97%Color and Shape:SolidMolecular weight:151.1890Thieno[2,3-d]pyrimidin-4-amine
CAS:Thieno[2,3-d]pyrimidin-4-amineFormula:C6H5N3SPurity:97%Molecular weight:151.19Thieno[2,3-d]pyrimidin-4-amine
CAS:Formula:C6H5N3SPurity:97%Color and Shape:SolidMolecular weight:151.194-Aminothieno[2,3-d]pyrimidine
CAS:4-Aminothieno[2,3-d]pyrimidine is a potent inhibitor of the P-glycoprotein multidrug transporter. It has been shown to inhibit chloride transport in the kidney and gastrointestinal tract. 4-Aminothieno[2,3-d]pyrimidine also inhibits the function of amine oxidase, which is involved in the metabolism of endogenous compounds such as catecholamines and serotonin. This drug may also be effective against cancer cells. The mechanism of action for this drug is not well understood but it has been shown to have an effect on DNA replication and repair by inhibiting phosphorous acid and formamidines. 4-Aminothieno[2,3-d]pyrimidine can produce crosslinking between DNA strands that leads to chain termination or intramolecular hydrogen transfer with formamidines. This process produces formaldehyde, which can react with other molecules to produce crosslinks betweenFormula:C6H5N3SPurity:Min. 95%Molecular weight:151.19 g/mol




