CymitQuimica logo

CAS 1408076-24-3

:

1,1-Dimethylethyl N-(cis-3-amino-3-methylcyclobutyl)carbamate

Description:
1,1-Dimethylethyl N-(cis-3-amino-3-methylcyclobutyl)carbamate, identified by its CAS number 1408076-24-3, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. This compound includes a dimethyl group, contributing to its steric bulk, and a cyclobutyl moiety that introduces cyclic structure and potential conformational rigidity. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug design. Its cis configuration indicates specific stereochemistry, which can influence biological activity and interactions. The compound's solubility, stability, and reactivity would depend on its molecular structure and the functional groups present, making it a candidate for various applications in pharmaceuticals or agrochemicals. Further studies would be necessary to elucidate its specific properties, including melting point, boiling point, and biological activity.
Formula:C10H20N2O2
InChI:InChI=1/C10H20N2O2/c1-9(2,3)14-8(13)12-7-5-10(4,11)6-7/h7H,5-6,11H2,1-4H3,(H,12,13)/t7-,10+
InChI key:InChIKey=IDZXBLNHGNNOSO-WKFQBHICNA-N
SMILES:N(C(OC(C)(C)C)=O)[C@@H]1C[C@](C)(N)C1
Synonyms:
  • 1,1-Dimethylethyl N-(cis-3-amino-3-methylcyclobutyl)carbamate
  • tert-Butyl ((cis)-3-amino-3-methylcyclobutyl)carbamate
  • Carbamic acid, N-(cis-3-amino-3-methylcyclobutyl)-, 1,1-dimethylethyl ester
Found 5 products.