CAS 141032-72-6
:Pyrazolo[1,5-a]pyridin-4-ol
Description:
Pyrazolo[1,5-a]pyridin-4-ol is a heterocyclic organic compound characterized by a fused ring system that includes both pyrazole and pyridine moieties. This compound typically exhibits a range of interesting chemical properties due to the presence of nitrogen atoms in its structure, which can influence its reactivity and interactions with other molecules. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties. The hydroxyl group (-OH) at the 4-position of the pyridine ring contributes to its ability to form hydrogen bonds, enhancing its solubility in polar solvents. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, making it a valuable intermediate in organic synthesis. Its unique structure and properties make it a subject of interest in medicinal chemistry and material science. As with many heterocycles, the stability and reactivity can vary based on substituents and environmental conditions, which are important considerations in its application and study.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c10-7-2-1-5-9-6(7)3-4-8-9/h1-5,10H
InChI key:UYVZRUORQWAFPS-UHFFFAOYSA-N
SMILES:C1=CN2C(=CC=N2)C(=C1)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Pyrazolo[1,5-a]pyridin-4-ol
CAS:Pyrazolo[1,5-a]pyridin-4-olFormula:C7H6N2OPurity:97%Molecular weight:134.14Pyrazolo[1,5-a]pyridin-4-ol
CAS:Formula:C7H6N2OPurity:97%Color and Shape:SolidMolecular weight:134.1353Pyrazolo[1,5-a]pyridin-4-ol
CAS:Pyrazolo[1,5-a]pyridin-4-olFormula:C7H6N2OPurity:95%Molecular weight:134.14Pyrazolo[1,5-a]pyridin-4-ol
CAS:Pyrazolo[1,5-a]pyridin-4-ol is a heteroaromatic compound that acts as an inhibitor of phosphodiesterase (PDE). It prevents the breakdown of cyclic nucleotides and thus leads to increased levels of cAMP and cGMP. Pyrazolo[1,5-a]pyridin-4-ol has been shown to have bronchodilatory activity in animal models. The drug also inhibits the production of inflammatory mediators such as prostaglandins by inhibiting cyclooxygenases. In addition, pyrazolo[1,5-a]pyridin-4-ol has been shown to be a potential PDE inhibitor replacement for the more commonly used PDE inhibitors such as sildenafil and tadalafil. However, due to its lack of stereochemistry and its bicyclic chemical structure, pyrazolo[1,5-a]
Formula:C7H6N2OPurity:Min. 95%Molecular weight:134.14 g/mol




