CymitQuimica logo

CAS 141134-24-9

:

4-(difluoromethoxy)phenacyl bromide

Description:
4-(Difluoromethoxy)phenacyl bromide is an organic compound characterized by its unique structure, which includes a phenacyl group and a difluoromethoxy substituent. This compound typically appears as a solid at room temperature and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromide leaving group. The difluoromethoxy group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is generally handled with care due to its reactivity and potential toxicity, and appropriate safety measures should be taken during its synthesis and use. As with many halogenated compounds, it may also exhibit specific environmental considerations regarding its stability and degradation. Overall, 4-(difluoromethoxy)phenacyl bromide is a valuable compound for research and development in organic synthesis and related applications.
Formula:C9H7BrF2O2
InChI:InChI=1/C9H7BrF2O2/c10-5-8(13)6-1-3-7(4-2-6)14-9(11)12/h1-4,9H,5H2
InChI key:JMUKUVDYZQDUSP-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)CBr)OC(F)F
Synonyms:
  • 2-Bromo-1-[4-(difluoromethoxy)phenyl]ethan-1-one
  • 2-Bromo-1-[4-(Difluoromethoxy)Phenyl]Ethanone
Found 2 products.