CymitQuimica logo

CAS 141193-65-9

:

L-Serine, N-methyl-, hydrochloride

Description:
L-Serine, N-methyl-, hydrochloride is a chemical compound that belongs to the class of amino acids, specifically a derivative of serine. It is characterized by the presence of a methyl group attached to the nitrogen atom of the serine structure, which alters its properties compared to the parent amino acid. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water, making it suitable for various applications in biochemistry and pharmaceuticals. L-Serine is known for its role in protein synthesis and as a precursor for several important biomolecules, including neurotransmitters. The hydrochloride form is often used in research and clinical settings due to its stability and ease of handling. In terms of safety, like many amino acid derivatives, it should be handled with care, following appropriate safety protocols. Its specific applications may include use in cell culture, as a supplement in nutritional formulations, or in the synthesis of other chemical compounds.
Formula:C4H9NO3・ClH
InChI:InChI=1S/C4H9NO3.ClH/c1-5-3(2-6)4(7)8;/h3,5-6H,2H2,1H3,(H,7,8);1H/t3-;/m0./s1
InChI key:ZLTMGTWVKIIMRC-DFWYDOINSA-N
SMILES:CN[C@@H](CO)C(=O)O.Cl
Found 5 products.