CymitQuimica logo

CAS 1413285-68-3

:

1-(5-bromo-4-methylpyridin-2-yl)ethanone

Description:
1-(5-bromo-4-methylpyridin-2-yl)ethanone is an organic compound characterized by its pyridine ring structure, which is substituted with a bromine atom and a methyl group. The presence of the ethanone functional group indicates that it contains a carbonyl (C=O) group adjacent to an ethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential reactivity due to the electrophilic nature of the carbonyl group. Its molecular structure suggests it may participate in various chemical reactions, such as nucleophilic additions or substitutions, due to the electron-withdrawing effects of the bromine atom and the electron-donating effects of the methyl group. The compound may also display moderate solubility in organic solvents, influenced by its polar carbonyl group and non-polar aromatic system. Additionally, it may have applications in medicinal chemistry or as an intermediate in organic synthesis, owing to the functional groups present in its structure. Safety and handling precautions should be observed, as with any brominated organic compound.
Formula:C8H8BrNO
InChI:InChI=1S/C8H8BrNO/c1-5-3-8(6(2)11)10-4-7(5)9/h3-4H,1-2H3
InChI key:IZQZLUANDRPXSO-UHFFFAOYSA-N
SMILES:CC1=CC(=NC=C1Br)C(=O)C
Found 4 products.