CymitQuimica logo

CAS 1414513-75-9

:

6-Phenyl-2-oxaspiro[3.3]heptane-6-carbonitrile

Description:
6-Phenyl-2-oxaspiro[3.3]heptane-6-carbonitrile is a chemical compound characterized by its unique spirocyclic structure, which features a phenyl group and a carbonitrile functional group. The spirocyclic framework consists of two interconnected rings that share a single atom, contributing to its distinctive three-dimensional shape. The presence of the oxaspiro moiety indicates that one of the rings contains an oxygen atom, which can influence the compound's reactivity and stability. The carbonitrile group introduces a polar functional group, enhancing the compound's potential for hydrogen bonding and affecting its solubility in various solvents. This compound may exhibit interesting biological or pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, 6-Phenyl-2-oxaspiro[3.3]heptane-6-carbonitrile represents a complex organic molecule with potential applications in various fields of research.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c14-8-13(11-4-2-1-3-5-11)6-12(7-13)9-15-10-12/h1-5H,6-7,9-10H2
InChI key:InChIKey=QZGRQRCGRXVDNX-UHFFFAOYSA-N
SMILES:C(#N)C1(CC2(C1)COC2)C3=CC=CC=C3
Synonyms:
  • 2-Oxaspiro[3.3]heptane-6-carbonitrile, 6-phenyl-
  • 6-Phenyl-2-oxaspiro[3.3]heptane-6-carbonitrile
Found 3 products.