CymitQuimica logo

CAS 1414958-88-5

:

2-Thiazolemethanamine, 5-bromo-, hydrochloride (1:1)

Description:
2-Thiazolemethanamine, 5-bromo-, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen. The presence of the bromine atom at the 5-position of the thiazole ring contributes to its reactivity and potential applications in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its usability in various chemical reactions and biological assays. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for interactions with biological targets, potentially influencing enzyme activity or receptor binding. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 2-Thiazolemethanamine, 5-bromo-, hydrochloride (1:1) represents a valuable compound in the field of organic synthesis and drug discovery.
Formula:C4H5BrN2S·ClH
InChI:InChI=1S/C4H5BrN2S.ClH/c5-3-2-7-4(1-6)8-3;/h2H,1,6H2;1H
InChI key:InChIKey=LLSQJRJUBNDTTK-UHFFFAOYSA-N
SMILES:C(N)C=1SC(Br)=CN1.Cl
Synonyms:
  • 2-Thiazolemethanamine, 5-bromo-, hydrochloride (1:1)
Found 5 products.