CymitQuimica logo

CAS 14150-64-2

:

2-Hydrazinylacetic acid

Description:
2-Hydrazinylacetic acid, with the CAS number 14150-64-2, is an organic compound characterized by the presence of both hydrazine and acetic acid functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water due to its polar nature. The compound features a hydrazine (-NH2-NH-) moiety attached to an acetic acid (-COOH) group, which contributes to its reactivity and potential applications in various chemical syntheses. 2-Hydrazinylacetic acid is known for its role as a building block in the synthesis of more complex molecules, particularly in medicinal chemistry and biochemistry. It can participate in various chemical reactions, including condensation and coupling reactions, making it valuable in the development of pharmaceuticals and agrochemicals. Additionally, due to the presence of the hydrazine group, it may exhibit biological activity, which warrants careful handling due to potential toxicity. Overall, 2-Hydrazinylacetic acid is a versatile compound with significant implications in research and industrial applications.
Formula:C2H6N2O2
InChI:InChI=1S/C2H6N2O2/c3-4-1-2(5)6/h4H,1,3H2,(H,5,6)
InChI key:InChIKey=RRBZUCWNYQUCTR-UHFFFAOYSA-N
SMILES:C(C(O)=O)NN
Synonyms:
  • 2-Hydrazinylacetic acid
  • Acetic acid, 2-hydrazinyl-
  • Acetic acid, hydrazino-
  • Glycine, N-amino-
  • Hydrazineacetic acid
  • Hydrazinylacetic Acid
  • Hydrazinoacetic acid
Found 6 products.