CymitQuimica logo

CAS 1415560-69-8

:

2-Pyridinamine, 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-piperidinyl)-1H-pyrazol-4-yl]-, hydrochloride (1:1)

Description:
2-Pyridinamine, 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-piperidinyl)-1H-pyrazol-4-yl]-, hydrochloride (1:1), with CAS number 1415560-69-8, is a chemical compound characterized by its complex structure, which includes a pyridinamine core, an ethoxy group, and a piperidinyl-substituted pyrazole moiety. This compound is typically classified as a hydrochloride salt, indicating that it is a protonated form of the base compound, enhancing its solubility in water and biological fluids. The presence of halogen substituents, such as dichloro and fluorine atoms, suggests potential biological activity, possibly influencing its pharmacological properties. The compound may exhibit interactions with various biological targets, making it of interest in medicinal chemistry and drug development. Its specific applications and efficacy would depend on further studies, including pharmacokinetics and toxicity assessments. As with many synthetic compounds, handling should be conducted with care, adhering to safety protocols due to potential hazards associated with its chemical structure.
Formula:C21H22Cl2FN5O·ClH
InChI:InChI=1S/C21H22Cl2FN5O.ClH/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(9-27-21(18)25)14-10-28-29(11-14)15-4-6-26-7-5-15;/h2-3,8-12,15,26H,4-7H2,1H3,(H2,25,27);1H/t12-;/m1./s1
InChI key:InChIKey=BTDNHKQCPIBABF-UTONKHPSSA-N
SMILES:O([C@H](C)C1=C(Cl)C(F)=CC=C1Cl)C2=CC(C3=CN(N=C3)C4CCNCC4)=CN=C2N.Cl
Synonyms:
  • 2-Pyridinamine, 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-piperidinyl)-1H-pyrazol-4-yl]-, hydrochloride (1:1)
Found 3 products.