CymitQuimica logo

CAS 1415562-38-7

:

1,1-Dimethylethyl N-[2-(2-oxa-6-azaspiro[3.3]hept-6-yl)ethyl]carbamate

Description:
1,1-Dimethylethyl N-[2-(2-oxa-6-azaspiro[3.3]hept-6-yl)ethyl]carbamate, identified by its CAS number 1415562-38-7, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a spirocyclic moiety. The presence of the dimethyl group contributes to its steric properties, while the spirocyclic structure introduces rigidity and potential for specific interactions with biological targets. This compound may exhibit interesting pharmacological properties due to its complex architecture, which can influence its solubility, stability, and reactivity. Additionally, the oxazolidine and azaspiro components suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation through pharmacokinetic and pharmacodynamic studies. Overall, this compound represents a fascinating example of how structural diversity in organic molecules can lead to varied biological activities.
Formula:C12H22N2O3
InChI:InChI=1S/C12H22N2O3/c1-11(2,3)17-10(15)13-4-5-14-6-12(7-14)8-16-9-12/h4-9H2,1-3H3,(H,13,15)
InChI key:InChIKey=ZRCFEOGZVNDJGT-UHFFFAOYSA-N
SMILES:C(CNC(OC(C)(C)C)=O)N1CC2(C1)COC2
Synonyms:
  • Carbamic acid, N-[2-(2-oxa-6-azaspiro[3.3]hept-6-yl)ethyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[2-(2-oxa-6-azaspiro[3.3]hept-6-yl)ethyl]carbamate
  • tert-butyl (2-(2-oxa-6-azaspiro[3.3]heptan-6-yl)ethyl)carbaMate
Found 3 products.