CymitQuimica logo

CAS 14161-11-6

:

3,4,5-Trichloropyridazine

Description:
3,4,5-Trichloropyridazine is a chlorinated heterocyclic compound characterized by its pyridazine ring, which consists of two adjacent nitrogen atoms in a six-membered aromatic structure. The presence of three chlorine atoms at the 3, 4, and 5 positions of the pyridazine ring significantly influences its chemical properties, making it a highly polar and potentially reactive compound. It is typically a solid at room temperature and may exhibit low solubility in water while being more soluble in organic solvents. This compound is of interest in various fields, including agrochemicals and pharmaceuticals, due to its potential biological activity. Its reactivity can lead to various chemical transformations, making it useful in synthetic organic chemistry. However, handling 3,4,5-trichloropyridazine requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures during its use and disposal. Overall, its unique structure and properties make it a subject of interest for further research and application in chemical synthesis and development.
Formula:C4HCl3N2
InChI:InChI=1S/C4HCl3N2/c5-2-1-8-9-4(7)3(2)6/h1H
InChI key:InChIKey=GBAOOJAWDCNOGO-UHFFFAOYSA-N
SMILES:ClC=1C(Cl)=CN=NC1Cl
Synonyms:
  • Nsc 75074
  • Pyridazine, 3,4,5-trichloro-
  • 3,4,5-Trichloropyridazine
Found 5 products.