CymitQuimica logo

CAS 1416134-63-8

:

(2S,5R)-7-Oxo-6-(phenylmethoxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid ethyl ester

Description:
The chemical substance known as "(2S,5R)-7-Oxo-6-(phenylmethoxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid ethyl ester," with the CAS number 1416134-63-8, is characterized by its complex bicyclic structure, which includes a diazabicyclo framework. This compound features a carboxylic acid ester functional group, specifically an ethyl ester, which contributes to its solubility and reactivity. The presence of a phenylmethoxy group enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. The stereochemistry indicated by the (2S,5R) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and pharmacokinetics. Additionally, the keto group at the 7-position plays a role in the compound's reactivity and stability. Overall, this substance may exhibit unique properties that could be explored for therapeutic applications, particularly in the context of drug design and development.
Formula:C16H20N2O4
InChI:InChI=1S/C16H20N2O4/c1-2-21-15(19)14-9-8-13-10-17(14)16(20)18(13)22-11-12-6-4-3-5-7-12/h3-7,13-14H,2,8-11H2,1H3/t13-,14+/m1/s1
InChI key:PVECPYUZEQQDKD-KGLIPLIRSA-N
SMILES:CCOC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OCC3=CC=CC=C3
Found 5 products.