CymitQuimica logo

CAS 1416367-18-4

:

Isothiazolidine, 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-, 1,1-dioxide

Description:
Isothiazolidine, 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-, 1,1-dioxide, identified by CAS number 1416367-18-4, is a chemical compound characterized by its unique isothiazolidine structure, which incorporates a sulfur atom and a nitrogen atom within a five-membered ring. The presence of the 1,1-dioxide functional group indicates that it has two double-bonded oxygen atoms attached to the sulfur atom, enhancing its reactivity and potential applications in various chemical reactions. The compound also features a phenyl group substituted with a boron-containing moiety, specifically a tetramethyl-1,3,2-dioxaborolane, which can impart interesting properties such as increased stability and potential for coordination chemistry. This combination of functional groups suggests that the compound may exhibit unique biological activities or serve as a useful intermediate in organic synthesis. Its specific applications and behavior in chemical reactions would depend on the context of use, including potential roles in medicinal chemistry or materials science.
Formula:C15H22BNO4S
InChI:InChI=1S/C15H22BNO4S/c1-14(2)15(3,4)21-16(20-14)12-7-5-8-13(11-12)17-9-6-10-22(17,18)19/h5,7-8,11H,6,9-10H2,1-4H3
InChI key:InChIKey=JZCJAHUPVJCLCO-UHFFFAOYSA-N
SMILES:CC1(C)OB(C2=CC(=CC=C2)N3S(=O)(=O)CCC3)OC1(C)C
Synonyms:
  • Isothiazolidine, 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-, 1,1-dioxide
  • 3-(1,1-Dioxido-2-isothiazolidinyl)phenylboronic acid pinacol ester
  • 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)isothiazolidine 1,1-dioxide
Found 3 products.