CymitQuimica logo

CAS 1416439-08-1

:

Spiro[3.3]heptan-2-amine, hydrochloride (1:1)

Description:
Spiro[3.3]heptan-2-amine, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which consists of a seven-membered ring fused to another three-membered ring. This compound features an amine functional group, which contributes to its basicity and potential reactivity in various chemical environments. As a hydrochloride salt, it is typically encountered in a crystalline form, enhancing its solubility in polar solvents, particularly water. The presence of the hydrochloride indicates that the amine is protonated, which can influence its pharmacological properties and interactions with biological systems. This compound may exhibit interesting stereochemical properties due to its spiro configuration, potentially affecting its biological activity and binding affinity in medicinal chemistry applications. Its specific applications and effects would depend on further studies, including its interaction with receptors or enzymes. Overall, Spiro[3.3]heptan-2-amine, hydrochloride is a compound of interest in organic synthesis and medicinal chemistry, warranting further investigation for its potential uses.
Formula:C7H13N·ClH
InChI:InChI=1S/C7H13N.ClH/c8-6-4-7(5-6)2-1-3-7;/h6H,1-5,8H2;1H
InChI key:InChIKey=GXRHXOCHXRWKAR-UHFFFAOYSA-N
SMILES:NC1CC2(C1)CCC2.Cl
Synonyms:
  • Spiro[3.3]heptan-2-amine hydrochloride
  • Spiro[3.3]heptan-2-amine, hydrochloride (1:1)
Found 5 products.