CymitQuimica logo

CAS 1416712-45-2

:

benzyl 2-cyano-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate

Description:
Benzyl 2-cyano-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core, a cyano group, and an ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the cyano group may impart unique reactivity, making it a candidate for various synthetic applications, including medicinal chemistry. The benzyl group enhances lipophilicity, which can influence the compound's pharmacokinetics and interactions with biological targets. Additionally, the carboxylate moiety can participate in hydrogen bonding and ionic interactions, further affecting its chemical behavior. Overall, this compound may serve as a valuable intermediate in the synthesis of more complex molecules or as a lead compound in drug discovery, particularly in the development of therapeutics targeting specific biological pathways. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise details.
Formula:C17H15N3O2
InChI:InChI=1S/C17H15N3O2/c18-10-15-7-6-14-11-20(9-8-16(14)19-15)17(21)22-12-13-4-2-1-3-5-13/h1-7H,8-9,11-12H2
InChI key:SWXVOBKLOXXOKT-UHFFFAOYSA-N
SMILES:C1CN(CC2=C1N=C(C=C2)C#N)C(=O)OCC3=CC=CC=C3
Synonyms:
  • benzyl 2-cyano-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate
  • 1,6-Naphthyridine-6(5H)-carboxylic acid, 2-cyano-7,8-dihydro-, phenylmethyl ester
Found 3 products.