CymitQuimica logo

CAS 141699-58-3

:

1-(Tert-butoxycarbonyl)-3-(methanesulfonyloxy)azetidine

Description:
1-(Tert-butoxycarbonyl)-3-(methanesulfonyloxy)azetidine is a chemical compound characterized by its unique structural features, which include a four-membered azetidine ring. The tert-butoxycarbonyl (Boc) group serves as a protective group for amines, enhancing the compound's stability and reactivity in various chemical reactions. The methanesulfonyloxy group, also known as a mesylate, is a good leaving group, making the compound useful in nucleophilic substitution reactions. This compound is typically utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to facilitate the introduction of functional groups. Its molecular structure contributes to its solubility and reactivity, which are important for its applications in synthetic chemistry. Additionally, the presence of both the Boc and mesylate groups allows for selective reactions, making it a versatile intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many organic compounds, due to potential hazards associated with its reactivity and toxicity.
Formula:C9H17NO5S
InChI:InChI=1/C9H17NO5S/c1-9(2,3)14-8(11)10-5-7(6-10)15-16(4,12)13/h7H,5-6H2,1-4H3
InChI key:XXBDTKYKFFIAEY-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(C1)OS(=O)(=O)C
Synonyms:
  • 1-(Tert-Butoxycarbonyl)Azetidine-3-Yl-Methanesulfonate
  • 1-(Tert-Butoxycarbonyl)Azetidine-3-Carboxylic Acid
  • Tert-Butyl 3-[(Methylsulfonyl)Oxy]Azetidine-1-Carboxylate
  • 1-Boc-3-(methanesulfonyloxy)azetidine
  • Tert-Butyl 3-(Methanesulfonyloxy)Azetidine-1-Carboxylate
Found 5 products.