CAS 14179-84-1
:2-Oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
Description:
2-Oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, with the CAS number 14179-84-1, is a heterocyclic organic compound characterized by its fused ring structure, which includes a quinoline moiety. This compound features a carboxylic acid functional group and a ketone group, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid, soluble in polar solvents, and may exhibit moderate stability under standard conditions. The presence of both the carboxylic acid and ketone functionalities suggests that it can participate in various chemical reactions, including esterification and condensation. This compound has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its structural features may also allow for interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-4,7H,5H2,(H,11,12)(H,13,14)
InChI key:UFTLCDHPTBFVHE-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)C(CC(=N2)O)C(=O)O
Synonyms:- 4-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-2-oxo-
- 2-Oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Oxo-1,2,3,4-Tetrahydroquinoline-4-Carboxylic Acid
CAS:Formula:C10H9NO3Purity:95%Color and Shape:SolidMolecular weight:191.18342-Oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
CAS:2-Oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid is a carboxylic acid that is an intermediate in the chemical synthesis of 2H and 3H tetrahydroquinolines. It can be synthesized by the oxidation of 2-(N,N-dimethylamino)benzaldehyde with hydrogen peroxide in methanol. The compound has been used to label animals for use in mass spectrometry studies and as a reactant in electron and nuclear magnetic resonance (NMR) spectroscopy experiments. In addition, 2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid has been used to study equilibrium and reversible reactions as well as to identify the abundances of different spectral peaks. 2-Oxo-1,2,3,4-tetrahydroquinoline-4Formula:C10H9NO3Purity:Min. 95%Molecular weight:191.18 g/mol2-Oxo-1,2,3,4-tetrahydro-quinoline-4-carboxylic acid
CAS:Formula:C10H9NO3Purity:95.0%Color and Shape:Solid, CrystallineMolecular weight:191.186


