
CAS 141794-41-4
:1-Amino-2-(2,4-dimethylphenoxy)-4-hydroxy-9,10-anthracenedione
Description:
1-Amino-2-(2,4-dimethylphenoxy)-4-hydroxy-9,10-anthracenedione, with CAS number 141794-41-4, is a synthetic organic compound characterized by its complex structure, which includes an anthraquinone backbone. This compound features an amino group and a hydroxy group, contributing to its potential reactivity and solubility in various solvents. The presence of the 2,4-dimethylphenoxy substituent enhances its hydrophobic properties, which may influence its biological activity and interactions with other molecules. Typically, compounds of this nature are studied for their potential applications in fields such as dye chemistry, pharmaceuticals, and materials science due to their chromophoric properties and ability to participate in electron transfer processes. The compound may exhibit various biological activities, including antimicrobial or anticancer properties, although specific biological data would require further investigation. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a class of organic molecules with diverse applications and significant interest in chemical research.
Formula:C22H17NO4
InChI:InChI=1S/C22H17NO4/c1-11-7-8-16(12(2)9-11)27-17-10-15(24)18-19(20(17)23)22(26)14-6-4-3-5-13(14)21(18)25/h3-10,24H,23H2,1-2H3
InChI key:InChIKey=PHZDDNRFLBMCNJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=C(O)C=C(OC4=C(C)C=C(C)C=C4)C2N
Synonyms:- 1-Amino-2-(2,4-dimethylphenoxy)-4-hydroxy-9,10-anthracenedione
- 9,10-Anthracenedione, 1-amino-2-(2,4-dimethylphenoxy)-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Amino-2-(2,4-dimethylphenoxy)-4-hydroxyanthracene-9,10-dione
CAS:Formula:C22H17NO4Molecular weight:359.3747
