CymitQuimica logo

CAS 1418306-00-9

:

N-(5-(6-methylpyridin-2-yl)-1H-imidazol-2-yl)acetamide

Description:
N-(5-(6-methylpyridin-2-yl)-1H-imidazol-2-yl)acetamide is a chemical compound characterized by its complex structure, which includes an imidazole ring and a pyridine moiety. This compound features a 6-methylpyridine group attached to a 1H-imidazole ring, which contributes to its potential biological activity. The acetamide functional group enhances its solubility and reactivity. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, which can influence their interaction with biological systems. The presence of nitrogen atoms in both the imidazole and pyridine rings may also impart basic characteristics, allowing for potential interactions with various biological targets. Additionally, the compound may be of interest in medicinal chemistry for its potential pharmacological applications, including antimicrobial or anticancer activities, although specific biological data would be required to confirm such properties. Overall, the unique structural features of N-(5-(6-methylpyridin-2-yl)-1H-imidazol-2-yl)acetamide suggest it could be a valuable compound for further research in drug development.
Formula:C11H12N4O
InChI:InChI=1S/C11H12N4O/c1-7-4-3-5-9(13-7)10-6-12-11(15-10)14-8(2)16/h3-6H,1-2H3,(H2,12,14,15,16)
InChI key:FCUDIQJEUIDEOF-UHFFFAOYSA-N
SMILES:CC1=NC(=CC=C1)C2=CN=C(N2)NC(=O)C
Synonyms:
  • N-(5-(6-methylpyridin-2-yl)-1H-imidazol-2-yl)acetamide
  • N-(4-(6-methylpyridin-2-yl)-1H-imidazol-2-yl)acetamide
  • Acetamide, N-[5-(6-methyl-2-pyridinyl)-1H-imidazol-2-yl]-
  • N-[5-(6-methyl-2-pyridinyl)-1H-imidazol-2-yl]-Acetamide
Found 3 products.