CymitQuimica logo

CAS 141836-50-2

:

[4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol

Description:
[4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol, with the CAS number 141836-50-2, is an organic compound characterized by its unique structural features. It contains a cyclohexyl ring, which contributes to its cyclic structure and potential steric effects. The presence of a tert-butyldimethylsilyl group enhances its stability and hydrophobic properties, making it useful in various chemical applications, particularly in organic synthesis and as a protecting group in reactions involving alcohols. The methanol functional group indicates that the compound has hydroxyl (-OH) functionality, which can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit moderate polarity due to the hydroxyl group while retaining hydrophobic characteristics from the silyl group. Its synthesis and manipulation require careful handling due to the potential reactivity of the silyl ether and the alcohol. Overall, this compound is of interest in fields such as medicinal chemistry and materials science, where its unique properties can be exploited for specific applications.
Formula:C14H30O2Si
InChI:InChI=1S/C14H30O2Si/c1-14(2,3)17(4,5)16-11-13-8-6-12(10-15)7-9-13/h12-13,15H,6-11H2,1-5H3
InChI key:DWUPTNCOHZJANV-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OCC1CCC(CC1)CO
Synonyms:
  • trans-[4-(tert-butyl-dimethyl-silanyloxymethyl)-cyclohexyl]-methanol
  • CyclohexaneMethanol, 4-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]Methyl]-
  • 4-[[[(1,1-DiMethylethyl)diMethylsilyl]oxy]Methyl]cyclohexaneMethanol
  • [4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
Found 3 products.