CAS 141947-42-4
:(3R,10S,8E)-10-Hydroperoxy-1,8-heptadecadiene-4,6-diyn-3-ol
Description:
(3R,10S,8E)-10-Hydroperoxy-1,8-heptadecadiene-4,6-diyn-3-ol, with the CAS number 141947-42-4, is a complex organic compound characterized by its unique structure featuring multiple functional groups, including hydroperoxy, alkenyl, and alkynyl moieties. This compound belongs to a class of polyunsaturated fatty acids and is notable for its potential biological activity, particularly in the context of signaling pathways and oxidative stress. The presence of hydroperoxy groups suggests that it may participate in redox reactions, making it a candidate for further investigation in biochemical studies. Its stereochemistry, indicated by the (3R,10S) configuration, implies specific spatial arrangements that can influence its reactivity and interactions with biological molecules. Additionally, the compound's diene and diyn structure contributes to its potential as a precursor in synthetic organic chemistry or as a bioactive molecule in natural product research. Overall, (3R,10S,8E)-10-Hydroperoxy-1,8-heptadecadiene-4,6-diyn-3-ol represents a fascinating subject for further exploration in both synthetic and medicinal chemistry.
Formula:C17H24O3
InChI:InChI=1S/C17H24O3/c1-3-5-6-7-11-14-17(20-19)15-12-9-8-10-13-16(18)4-2/h4,12,15-19H,2-3,5-7,11,14H2,1H3/b15-12+/t16-,17+/m1/s1
InChI key:InChIKey=SYNBBWLEYQBFQT-ODQHEUEKSA-N
SMILES:[C@@H](/C=C/C#CC#C[C@@H](C=C)O)(CCCCCCC)OO
Synonyms:- (-)-GinsenoyneK
- (3R,10S,8E)-10-Hydroperoxy-1,8-heptadecadiene-4,6-diyn-3-ol
- Ginsenoyne K
- 1,8-Heptadecadiene-4,6-diyn-3-ol, 10-hydroperoxy-, (3R,10S,8E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ginsenoyne K
CAS:Ginsenoyne K is a useful organic compound for research related to life sciences and the catalog number is T125902.Formula:C17H24O3Color and Shape:SolidMolecular weight:276.37Ginsenoyne K
CAS:Ginsenoyne K is a ginsenoside, which is a type of saponin compound derived from the roots of the Panax ginseng plant. This product originates from a natural source, specifically the roots of the ginseng plant, which are known for their rich profile of bioactive compounds. Ginsenoyne K functions primarily through modulating various signaling pathways within the human body, exhibiting properties such as anti-inflammatory, antioxidant, and potentially neuroprotective effects. This compound interacts with cellular mechanisms, allowing for the modulation of molecular targets that may help in reducing oxidative stress and inflammatory responses.Formula:C17H24O3Purity:Min. 95%Molecular weight:276.4 g/mol


