CAS 1420-07-1
:Dinoterb
Description:
Dinoterb, with the CAS number 1420-07-1, is a chemical compound primarily recognized as a herbicide. It belongs to the class of compounds known as phenoxy herbicides, which are commonly used in agricultural practices to control broadleaf weeds. Dinoterb is characterized by its selective action, targeting specific plant species while minimizing harm to crops. The compound is typically applied in various formulations, including emulsifiable concentrates and granules, and is effective in a range of environmental conditions. Its mode of action involves disrupting the growth processes of target plants, leading to their eventual death. Dinoterb is known for its relatively low toxicity to mammals, making it a preferred choice in certain agricultural applications. However, like many herbicides, it requires careful handling and application to mitigate potential environmental impacts, particularly concerning non-target species and water sources. Regulatory assessments often evaluate its environmental fate, persistence, and potential for bioaccumulation to ensure safe usage in agricultural settings.
Formula:C10H12N2O5
InChI:InChI=1S/C10H12N2O5/c1-10(2,3)7-4-6(11(14)15)5-8(9(7)13)12(16)17/h4-5,13H,1-3H3
InChI key:InChIKey=IIPZYDQGBIWLBU-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(O)C(N(=O)=O)=CC(N(=O)=O)=C1
Synonyms:- 2,4-Dinitro-6-tert-butylphenol
- 2-(1,1-Dimethylethyl)-4,6-dinitrophenol
- 2-Tert-Butyl-4,6-Dinitrophenol
- 4,6-Dinitro-2-tert-butylphenol
- Dinoterbe
- Dntbp
- Herbogil
- NSC 166496
- Phenol, 2-(1,1-dimethylethyl)-4,6-dinitro-
- Phenol, 2-tert-butyl-4,6-dinitro-
- Stirpan Forte
- Veraline Creme
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dinoterb 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C10H12N2O5Color and Shape:ColourlessMolecular weight:240.21Dinoterb
CAS:Controlled ProductDinoterb is a potent anticancer agent that belongs to the group of kinase inhibitors. It has been shown to induce apoptosis in cancer cells, making it an effective treatment for various types of tumors. Dinoterb has been found to be particularly effective against Chinese hamster ovary cells and human leukemia cells. This drug works by inhibiting the cell cycle, which prevents cancer cells from dividing and growing. Dinoterb is excreted mainly through urine and has been used in medicinal preparations as an inhibitor of protein kinases involved in cancer development. Its anti-tumor activity makes it a promising candidate for further research into cancer treatments.Formula:C10H12N2O5Purity:Min. 95%Molecular weight:240.21 g/mol


