CymitQuimica logo

CAS 14202-13-2

:

3-Methyltricyclo[3.3.1.13,7]decane-1-acetic acid

Description:
3-Methyltricyclo[3.3.1.1^3,7]decane-1-acetic acid, with the CAS number 14202-13-2, is a bicyclic compound characterized by its unique tricyclic structure. This compound features a methyl group and an acetic acid functional group, contributing to its chemical reactivity and potential applications. The presence of multiple rings in its structure often results in significant steric hindrance, influencing its physical properties such as boiling and melting points. Typically, compounds of this nature exhibit hydrophobic characteristics due to their hydrocarbon framework, which can affect their solubility in polar solvents. Additionally, the presence of the acetic acid moiety introduces acidic properties, allowing for potential interactions with bases or nucleophiles. The compound may also participate in various chemical reactions, including esterification or amidation, due to the functional groups present. Overall, 3-Methyltricyclo[3.3.1.1^3,7]decane-1-acetic acid is of interest in organic synthesis and may have implications in medicinal chemistry, although specific applications would depend on further research and exploration of its biological activity.
Formula:C13H20O2
InChI:InChI=1S/C13H20O2/c1-12-3-9-2-10(4-12)6-13(5-9,8-12)7-11(14)15/h9-10H,2-8H2,1H3,(H,14,15)
InChI key:InChIKey=OIASGIUDXARLDU-UHFFFAOYSA-N
SMILES:C(C(O)=O)C12CC3(C)CC(C1)CC(C2)C3
Synonyms:
  • 2-(3-Methyladamantan-1-yl)acetic acid
  • 1-Adamantaneacetic acid, 3-methyl-
  • Tricyclo[3.3.1.13,7]decane-1-acetic acid, 3-methyl-
  • 3-Methyl-1-adamantaneacetic acid
  • 3-Methyltricyclo[3.3.1.13,7]decane-1-acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.