CAS 142072-12-6: N-[(2R,3S,4R,5S,6S)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide
Description:N-[(2R,3S,4R,5S,6S)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide is a complex organic compound characterized by its azido and acetamide functional groups, along with a sugar-like tetrahydropyran structure. The presence of multiple hydroxyl groups contributes to its hydrophilicity, making it soluble in polar solvents. The azido group (-N3) is notable for its reactivity, particularly in click chemistry applications, allowing for further functionalization. The stereochemistry indicated by the (2R,3S,4R,5S,6S) configuration suggests that the compound has specific three-dimensional orientations, which can influence its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry and bioconjugation due to its potential applications in drug development and as a biochemical probe. Its molecular structure suggests it could participate in various chemical reactions, making it a versatile candidate for synthetic chemistry.
Formula:C10H18N4O6
InChI:InChI=1/C10H18N4O6/c1-5(16)13-7-9(18)8(17)6(4-15)20-10(7)19-3-2-12-14-11/h6-10,15,17-18H,2-4H2,1H3,(H,13,16)/t6-,7-,8+,9+,10+/m0/s1
InChI key:InChIKey=DHQJPCIPZHPDSL-VVULQXIFSA-N
SMILES:[N-]=[N+]=NCCOC1OC(CO)C(O)C(O)C1NC(=O)C
- Synonyms:
- 2-Azidoethyl 2-(acetylamino)-2-deoxy-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 2-Azidoethyl 2-Acetamido-2-deoxy-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 2-Azidoethyl 2-acetamido-2-deoxy-α-L-gulopyranoside
- 2-Azidoethyl N-acetyl-β-<span class="text-smallcaps">D</span>-glucosaminide
- α-L-gulopyranoside, 2-azidoethyl 2-(acetylamino)-2-deoxy-
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2-azidoethyl 2-(acetylamino)-2-deoxy-
![N-[(2R,3S,4R,5S,6S)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide](https://static.cymitquimica.com/cas-image/133554-n-2r-3s-4r-5s-6s-2-2-azidoethoxy-45-dihydroxy-6-hydroxymethyl-tetrahydropyran-3-yl-acetamide.png)
