CAS 142072-12-6
:N-[(2R,3S,4R,5S,6S)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide
Description:
N-[(2R,3S,4R,5S,6S)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide is a complex organic compound characterized by its azido and acetamide functional groups, along with a sugar-like tetrahydropyran structure. The presence of multiple hydroxyl groups contributes to its hydrophilicity, making it soluble in polar solvents. The azido group (-N3) is notable for its reactivity, particularly in click chemistry applications, allowing for further functionalization. The stereochemistry indicated by the (2R,3S,4R,5S,6S) configuration suggests that the compound has specific three-dimensional orientations, which can influence its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry and bioconjugation due to its potential applications in drug development and as a biochemical probe. Its molecular structure suggests it could participate in various chemical reactions, making it a versatile candidate for synthetic chemistry.
Formula:C10H18N4O6
InChI:InChI=1/C10H18N4O6/c1-5(16)13-7-9(18)8(17)6(4-15)20-10(7)19-3-2-12-14-11/h6-10,15,17-18H,2-4H2,1H3,(H,13,16)/t6-,7-,8+,9+,10+/m0/s1
InChI key:InChIKey=DHQJPCIPZHPDSL-VVULQXIFSA-N
SMILES:N(C(C)=O)[C@H]1[C@H](OCCN=[N+]=[N-])O[C@H](CO)[C@@H](O)[C@@H]1O
Synonyms:- 2-Azidoethyl 2-(acetylamino)-2-deoxy-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 2-Azidoethyl 2-Acetamido-2-deoxy-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 2-Azidoethyl 2-acetamido-2-deoxy-α-L-gulopyranoside
- 2-Azidoethyl N-acetyl-β-<span class="text-smallcaps">D</span>-glucosaminide
- α-L-gulopyranoside, 2-azidoethyl 2-(acetylamino)-2-deoxy-
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2-azidoethyl 2-(acetylamino)-2-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Azidoethyl 2-Acetamido-2-deoxy-β-D-glucopyranoside
CAS:Formula:C10H18N4O6Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:290.28β-D-Glucopyranoside, 2-azidoethyl 2-(acetylamino)-2-deoxy-
CAS:Formula:C10H18N4O6Purity:98%Color and Shape:SolidMolecular weight:290.27312-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranoside
CAS:2-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranosideFormula:C10H18N4O6Purity:98%Molecular weight:290.273112-Azidoethyl 2-acetamido-2-deoxy-b-D-glucopyranoside
CAS:2-Azidoethyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a toxic compound that inhibits protein synthesis by binding to the enzyme glucokinase. It has been shown to inhibit the release of fatty acids in hepatocytes and to inhibit triglyceride lipase activity in cell culture. This chemical also has a damaged sequence, which is a factor that may lead to toxicity. 2-Azidoethyl 2-acetamido-2-deoxy-b-D-glucopyranoside also has been shown to have physiological activities, such as inhibition of cardiac cells and symptoms such as inflammation. These effects are thought to be mediated by its ability to bind with DNA and RNA, altering their function.Formula:C10H18N4O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:290.27 g/mol2-Azidoethyl 2-Acetamido-2-deoxy-β-D-glucopyranoside
CAS:Controlled ProductApplications 2-Azidoethyl 2-Acetamido-2-deoxy-beta-D-glucopyranoside 142072-12-6 (cas# 142072-12-6) is a useful research chemical.
Formula:C10H18N4O6Color and Shape:NeatMolecular weight:290.28(diazyn-1-ium-1-yl)(2-{[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}ethyl)azanide
CAS:Purity:98%Molecular weight:290.276001






