CAS 1421-63-2
:2′,4′,5′-Trihydroxybutyrophenone
Description:
2′,4′,5′-Trihydroxybutyrophenone, with the CAS number 1421-63-2, is an organic compound characterized by its phenolic structure, which includes three hydroxyl (-OH) groups attached to a butyrophenone backbone. This compound typically exhibits properties associated with phenols, such as being a solid at room temperature and having potential antioxidant activity due to the presence of multiple hydroxyl groups. Its molecular structure allows for hydrogen bonding, which can influence its solubility in various solvents, often making it more soluble in polar solvents. The compound may also display biological activity, which could be of interest in pharmaceutical applications. Additionally, its chemical reactivity can be attributed to the hydroxyl groups, making it a candidate for further chemical modifications. Overall, 2′,4′,5′-Trihydroxybutyrophenone is notable for its potential applications in various fields, including medicinal chemistry and materials science, due to its unique structural features and properties.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-2-3-7(11)6-4-9(13)10(14)5-8(6)12/h4-5,12-14H,2-3H2,1H3
InChI key:InChIKey=SRUQARLMFOLRDN-UHFFFAOYSA-N
SMILES:C(CCC)(=O)C1=C(O)C=C(O)C(O)=C1
Synonyms:- 1-(2,4,5-Trihydroxyphenyl)-1-butanone
- 1-(2,4,5-Trihydroxyphenyl)Butan-1-One
- 1-Butanone, 1-(2,4,5-trihydroxyphenyl)-
- 2,4,5-Trihydroxybutyrophenone
- Ai3-26870
- Brn 2577028
- Butyrophenone, 2',4',5'-trihydroxy-
- Butyrophenone, 2′,4′,5′-trihydroxy-
- Ccris 6281
- Hsdb 4288
- Nsc 73478
- Thbp
- Trihydroxybutyrophenone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4,5-Trihydroxybutyrophenone
CAS:Formula:C10H12O4Purity:95%Color and Shape:SolidMolecular weight:196.19992',4',5'-Trihydroxybutyrophenone
CAS:2',4',5'-TrihydroxybutyrophenoneFormula:C10H12O4Purity:≥95%Color and Shape: tan solidMolecular weight:196.20g/molGB 5009.32-2016 Antioxidants Mixture 161 1000 mg/L in Acetonitrile
CAS:Controlled ProductColor and Shape:Mixture1-(2,4,5-Trihydroxyphenyl)butan-1-one
CAS:<p>1-(2,4,5-Trihydroxyphenyl)butan-1-one is a chemoattractant protein that is involved in the inflammatory response. It has been shown to be a potent stimulator of neutrophil migration in maternal blood and also has anti-inflammatory properties. 1-(2,4,5-Trihydroxyphenyl)butan-1-one may function as an adjuvant by activating immune cells and inducing cytokine production. 1-(2,4,5-Trihydroxyphenyl)butan-1-one also functions as a cofactor for dopamine and dinucleotide phosphate activity in the central nervous system. This protein has inhibitory properties against various biological activities of pharmacological agents such as histamine release and vascular permeability. Studies have shown that this compound can be toxic to mice when administered at high doses.</p>Formula:C10H12O4Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:196.2 g/mol





