CAS 14210-25-4
:5-Chloro-1-phenyl-1H-tetrazole
Description:
5-Chloro-1-phenyl-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. The presence of a chlorine atom at the 5-position and a phenyl group at the 1-position contributes to its unique reactivity and properties. This compound is typically a white to off-white solid and is known for its stability under standard conditions. It is often utilized in organic synthesis and pharmaceutical applications due to its ability to act as a building block for more complex molecules. The tetrazole moiety is of particular interest in medicinal chemistry, as it can mimic carboxylic acids and is involved in various biological activities. Additionally, 5-Chloro-1-phenyl-1H-tetrazole may exhibit properties such as solubility in organic solvents and potential reactivity with nucleophiles, making it a versatile compound in chemical research and development. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H5ClN4
InChI:InChI=1S/C7H5ClN4/c8-7-9-10-11-12(7)6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=DHELIGKVOGTMGF-UHFFFAOYSA-N
SMILES:ClC=1N(N=NN1)C2=CC=CC=C2
Synonyms:- 1-Phenyl-5-chlorotetrazole
- 1H-Tetrazole, 5-chloro-1-phenyl-
- 5-Chloro-1-phenyltetrazole
- N-Phenyl-5-chlorotetrazole
- 5-Chloro-1-phenyl-1H-tetrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-chloro-1-phenyl-1H-1,2,3,4-tetrazole
CAS:Formula:C7H5ClN4Purity:98%Color and Shape:SolidMolecular weight:180.59445-Chloro-1-phenyl-1H-1,2,3,4-tetraazole
CAS:5-Chloro-1-phenyl-1H-1,2,3,4-tetraazoleFormula:C7H5ClN4Purity:≥95%Color and Shape:SolidMolecular weight:180.59445-Chloro-1-phenyltetrazole
CAS:Formula:C7H5ClN4Purity:(Titration) ≥ 98.0%Color and Shape:White, off-white or pale yellow-green powderMolecular weight:180.605-Chloro-1-phenyl-1H-tetrazole
CAS:Formula:C7H5ClN4Purity:>98.0%(T)(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:180.605-Chloro-1-phenyl-1H-tetrazole
CAS:Formula:C7H5ClN4Purity:≥98%Color and Shape:SolidMolecular weight:180.65-chloro-1-phenyl-1h-1,2,3,4-tetraazole
CAS:5-Chloro-1-phenyl-1H-1,2,3,4-tetrazole (5CAT) is a dihedral molecule that contains phenyl groups and p-hydroxybenzoic acid. The argon (Ar) functionalities are activated by reaction with hydroxyl group to form the cross-coupling reaction between 5CAT and chloride (Cl). 5CAT has been shown to be a good substrate for 2D Nuclear Magnetic Resonance (NMR), as it has a protonated hydroxyl group. This functional group is also present on the chloro group of the 5CAT molecule. The vibrational analysis from the protonated hydroxyl group can be observed in the spectrum of 5CAT.
Formula:C7H5N4ClPurity:Min. 95%Molecular weight:180.59 g/mol





