CAS 14215-97-5
:1-O-ACETYL-2,3,5-TRI-O-BENZOYL-D-RIBOFURANOSE
Description:
1-O-Acetyl-2,3,5-tri-O-benzoyl-D-ribofuranose is a synthetic derivative of ribofuranose, a sugar component of nucleotides. This compound features multiple benzoyl groups, which are aromatic carbonyl moieties that enhance its lipophilicity and stability. The presence of the acetyl group at the 1-position contributes to its reactivity and solubility characteristics. Typically, this compound is utilized in organic synthesis, particularly in the preparation of nucleoside analogs and other glycosylated compounds. Its structure allows for specific interactions in biochemical pathways, making it of interest in medicinal chemistry. The compound is generally characterized by its solid state at room temperature, and it may exhibit distinct melting and boiling points, depending on its purity and crystalline form. Additionally, it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C28H24O9
InChI:InChI=1/C28H24O9/c1-18(29)34-28-24(37-27(32)21-15-9-4-10-16-21)23(36-26(31)20-13-7-3-8-14-20)22(35-28)17-33-25(30)19-11-5-2-6-12-19/h2-16,22-24,28H,17H2,1H3/t22-,23+,24+,28-/m1/s1
Synonyms:- 1-Acetyl-2,3,5-Tribenzoyl-3-D-Ribofuranoside
- Tri-O-Benzoyl-1-O-Acetyl-D-Ribofuranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
1-O-Acetyl-2,3,5-tri-O-benzoyl-D-ribofuranose
CAS:Formula:C28H24O9Purity:98%Color and Shape:SolidMolecular weight:504.4848(3R,4R,5R)-2-Acetoxy-5-((Benzoyloxy)Methyl)Tetrahydrofuran-3,4-Diyl Dibenzoate
CAS:(3R,4R,5R)-2-Acetoxy-5-((Benzoyloxy)Methyl)Tetrahydrofuran-3,4-Diyl DibenzoatePurity:98%Molecular weight:504.48g/mol1-O-Acetyl-2,3,5-Tri-O-Benzoyl-D-Ribofuranose extrapure, 98%
CAS:Formula:C28H24O9Purity:min. 98.0%Color and Shape:White to off-white, PowderMolecular weight:504.481-O-Acetyl-2,3,5-tri-O-benzoyl-α,β-D-ribofuranose
CAS:Controlled ProductApplications An inhibitor of neutrophil-keyhole limpet hemocyanin adhesion. Anti-inflammatory agent.
References Shappell, S., et al.: J. Immunol., 144, 2702 (1990), Ross, L., et al.: J. Biol. Chem., 267, 8537 (1992), Granger, D., et al.: J. Leukoc. Biol., 55, 662 (1994),Formula:C28H24O9Color and Shape:NeatMolecular weight:504.481-O-Acetyl-2,3,5-tri-O-benzoyl-D-ribofuranose
CAS:1-O-Acetyl-2,3,5-tri-O-benzoyl-D-ribofuranose is a kinetic inhibitor that binds to the active site of L1210 leukemia cells. It inhibits the growth of these cells by reacting with chloride ions and causing cross-coupling reactions. This leads to the production of 2,3,5 triacetylated benzoyl ribofuranoside and 2 aminoadenosine. The latter molecule has significant antitumor effects on human macrophages and Leishmania donovani. 1-O-Acetyl-2,3,5-tri-O-benzoyl-D-ribofuranose also has significant antitumor effects on guanosine and xanthosine in human tumor cells.Formula:C28H24O9Purity:Min. 95%Color and Shape:White PowderMolecular weight:504.48 g/mol









