CymitQuimica logo

CAS 14215-97-5

:

1-O-ACETYL-2,3,5-TRI-O-BENZOYL-D-RIBOFURANOSE

Description:
1-O-Acetyl-2,3,5-tri-O-benzoyl-D-ribofuranose is a synthetic derivative of ribofuranose, a sugar component of nucleotides. This compound features multiple benzoyl groups, which are aromatic carbonyl moieties that enhance its lipophilicity and stability. The presence of the acetyl group at the 1-position contributes to its reactivity and solubility characteristics. Typically, this compound is utilized in organic synthesis, particularly in the preparation of nucleoside analogs and other glycosylated compounds. Its structure allows for specific interactions in biochemical pathways, making it of interest in medicinal chemistry. The compound is generally characterized by its solid state at room temperature, and it may exhibit distinct melting and boiling points, depending on its purity and crystalline form. Additionally, it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C28H24O9
InChI:InChI=1/C28H24O9/c1-18(29)34-28-24(37-27(32)21-15-9-4-10-16-21)23(36-26(31)20-13-7-3-8-14-20)22(35-28)17-33-25(30)19-11-5-2-6-12-19/h2-16,22-24,28H,17H2,1H3/t22-,23+,24+,28-/m1/s1
InChI key:GCZABPLTDYVJMP-ASAMFVBJSA-N
SMILES:CC(=O)OC1[C@@H]([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4
Synonyms:
  • 1-Acetyl-2,3,5-Tribenzoyl-3-D-Ribofuranoside
  • Tri-O-Benzoyl-1-O-Acetyl-D-Ribofuranose
Found 11 products.