CAS 142469-14-5: Tritosulfuron
Description:Tritosulfuron is a sulfonylurea herbicide primarily used for the control of broadleaf weeds and certain grasses in various crops. Its chemical structure features a sulfonylurea moiety, which is characteristic of this class of herbicides, allowing it to inhibit the enzyme acetolactate synthase (ALS) in plants, disrupting amino acid synthesis and ultimately leading to plant death. Tritosulfuron is typically applied post-emergence and is known for its systemic action, meaning it is absorbed by the plant and translocated throughout its tissues. The substance is generally characterized by its moderate solubility in water and stability under normal environmental conditions, although it may degrade under extreme pH or temperature conditions. As with many herbicides, proper handling and application are crucial to minimize environmental impact and ensure safety. Additionally, it is important to follow regulatory guidelines regarding its use to prevent potential resistance development in target weed populations.
Formula:C13H9F6N5O4S
InChI:InChI=1S/C13H9F6N5O4S/c1-28-11-21-8(13(17,18)19)20-9(23-11)22-10(25)24-29(26,27)7-5-3-2-4-6(7)12(14,15)16/h2-5H,1H3,(H2,20,21,22,23,24,25)
InChI key:InChIKey=KVEQCVKVIFQSGC-UHFFFAOYSA-N
SMILES:O=C(NC1=NC(=NC(=N1)C(F)(F)F)OC)NS(=O)(=O)C=2C=CC=CC2C(F)(F)F
- Synonyms:
- BAS 635, N-[(4-Methoxy-6-trifluoromethyl-1,3,5-triazin-2-yl)aminocarbonyl]-2-(trifluoromethyl)benzenesulfonamide
- Bas 635
- Benzenesulfonamide, N-[[[4-methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]amino]carbonyl]-2-(trifluoromethyl)-
- Biathlon
- Chromotrope 2 R For Microscopy
- Lab 271272
- N-[[[4-Methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]amino]carbonyl]-2-(trifluoromethyl)benzenesulfonamide
- N-{[4-methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]carbamoyl}-2-(trifluoromethyl)benzenesulfonamide
- Tritosulfuron
