CymitQuimica logo

CAS 142494-70-0

:

2-Nitro-4-(trifluoromethoxy)benzoic acid

Description:
2-Nitro-4-(trifluoromethoxy)benzoic acid is an aromatic compound characterized by the presence of a nitro group and a trifluoromethoxy group attached to a benzoic acid structure. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The trifluoromethoxy group enhances the compound's lipophilicity and can influence its reactivity and solubility in organic solvents. The nitro group is known for its electron-withdrawing properties, which can affect the compound's electronic characteristics and reactivity in various chemical reactions. This substance is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of functional groups allows for potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Safety data should be consulted for handling, as compounds with nitro and trifluoromethyl groups can pose health and environmental risks.
Formula:C8H4F3NO5
InChI:InChI=1S/C8H4F3NO5/c9-8(10,11)17-4-1-2-5(7(13)14)6(3-4)12(15)16/h1-3H,(H,13,14)
InChI key:InChIKey=JANOFBIDZFXRKA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C(O)=O)C=CC(OC(F)(F)F)=C1
Synonyms:
  • Benzoic acid, 2-nitro-4-(trifluoromethoxy)-
  • 2-Nitro-4-(trifluoromethoxy)benzoic acid
Found 4 products.