CAS 142534-71-2
:2,3,5,6,8,8,10,10-octachlorobornane
Description:
2,3,5,6,8,8,10,10-octachlorobornane is a synthetic organic compound characterized by its extensive chlorination, which significantly alters its physical and chemical properties. This compound belongs to the class of chlorinated hydrocarbons, specifically derived from the bicyclic structure of bornane. The presence of eight chlorine atoms introduces high stability and hydrophobicity, making it resistant to degradation in the environment. As a result, octachlorobornane is likely to exhibit low volatility and high melting and boiling points. Its chlorinated nature may also impart potential bioaccumulation properties, raising concerns regarding environmental persistence and toxicity. The compound is not commonly found in nature and is primarily of interest in industrial applications or as a subject of environmental studies. Due to its structural complexity and the presence of multiple chlorine substituents, it may also exhibit unique reactivity patterns, particularly in reactions involving nucleophiles or under extreme conditions. Overall, 2,3,5,6,8,8,10,10-octachlorobornane represents a significant example of chlorinated organic compounds with implications for both chemistry and environmental science.
Formula:C10H10Cl8
InChI:InChI=1/C10H10Cl8/c1-9(7(15)16)2-3(11)5(13)10(9,8(17)18)6(14)4(2)12/h2-8H,1H3
SMILES:CC1(C2C(C(C1(C(C2Cl)Cl)C(Cl)Cl)Cl)Cl)C(Cl)Cl
Synonyms:- 2-Exo,3-Endo,5-Exo,6-Endo,8,8,10,10-Octachlorobornane
- (2R,3R,5R,6R,7S)-2,3,5,6-tetrachloro-1,7-bis(dichloromethyl)-7-methylbicyclo[2.2.1]heptane
- 2,3,5,6-Tetrachloro-1,7-Bis(Dichloromethyl)-7-Methylbicyclo[2.2.1]Heptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Toxaphene Parlar-No. 26 ca.1 µg/mL in Cyclohexane
CAS:Formula:C10H10Cl8Color and Shape:ColourlessMolecular weight:413.81Toxaphene Mix 1 1 µg/mL in Cyclohexane
CAS:Formula:C10H10Cl8Color and Shape:ColourlessMolecular weight:413.81(2R,3R,5R,6R,7R)-rel-2,3,5,6-Tetrachloro-1,7-Bis(dichloromethyl)-7-Methyl-Bicyclo[2.2.1]heptane
CAS:Formula:C10H10Cl8Molecular weight:413.79Ref: 4Z-B-236001
Discontinued product



